C10H12ClN3S — CID 43140317
4-(chloromethyl)-2-(1,3,5-trimethylpyrazol-4-yl)-1,3-thiazole (PubChem CID 43140317) has the molecular formula C10H12ClN3S and a molecular weight of 241.75 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(1,3,5-trimethylpyrazol-4-yl)-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-(1,3,5-trimethylpyrazol-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 43140317 |
| Molecular Formula | C10H12ClN3S |
| Molecular Weight | 241.75 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 4-(chloromethyl)-2-(1,3,5-trimethylpyrazol-4-yl)-1,3-thiazole |
| SMILES | Cc1nn(C)c(C)c1-c1nc(CCl)cs1 |
| InChI | InChI=1S/C10H12ClN3S/c1-6-9(7(2)14(3)13-6)10-12-8(4-11)5-15-10/h5H,4H2,1-3H3 |
| InChIKey | DVFPWZJHJJONCU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.75 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|