About 5-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]-2-fluorobenzoic acid
5-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]-2-fluorobenzoic acid (PubChem CID 43140851) has the molecular formula C12H11FN2O5S
and a molecular weight of 314.29 g/mol. Its IUPAC name is 5-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]-2-fluorobenzoic acid.
Molecular Properties
| Compound Name | 5-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]-2-fluorobenzoic acid |
| PubChem CID | 43140851 |
| Molecular Formula | C12H11FN2O5S |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 5-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]-2-fluorobenzoic acid |
| SMILES | CCc1noc(CS(=O)(=O)c2ccc(F)c(C(=O)O)c2)n1 |
| InChI | InChI=1S/C12H11FN2O5S/c1-2-10-14-11(20-15-10)6-21(18,19)7-3-4-9(13)8(5-7)12(16)17/h3-5H,2,6H2,1H3,(H,16,17) |
| InChIKey | JGLGWRKBKUTCPM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]-2-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]-2-fluorobenzoic acid?
The IUPAC name of 5-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]-2-fluorobenzoic acid (CID 43140851) is 5-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]-2-fluorobenzoic acid.
What is the SMILES notation for 5-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]-2-fluorobenzoic acid?
The canonical SMILES for 5-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]-2-fluorobenzoic acid is CCc1noc(CS(=O)(=O)c2ccc(F)c(C(=O)O)c2)n1.
What is the InChIKey of 5-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]-2-fluorobenzoic acid?
The InChIKey is JGLGWRKBKUTCPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FN2O5S/c1-2-10-14-11(20-15-10)6-21(18,19)7-3-4-9(13)8(5-7)12(16)17/h3-5H,2,6H2,1H3,(H,16,17).
What are the key properties of 5-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]-2-fluorobenzoic acid?
5-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]-2-fluorobenzoic acid has a molecular weight of 314.29 g/mol, XLogP of 1.44, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]-2-fluorobenzoic acid is sourced from PubChem (CID 43140851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).