C12H16N2O — CID 43142509
N,N-dimethyl-1,2,3,4-tetrahydroquinoline-6-carboxamide (PubChem CID 43142509) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N,N-dimethyl-1,2,3,4-tetrahydroquinoline-6-carboxamide.
| Compound Name | N,N-dimethyl-1,2,3,4-tetrahydroquinoline-6-carboxamide |
|---|---|
| PubChem CID | 43142509 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N,N-dimethyl-1,2,3,4-tetrahydroquinoline-6-carboxamide |
| SMILES | CN(C)C(=O)c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C12H16N2O/c1-14(2)12(15)10-5-6-11-9(8-10)4-3-7-13-11/h5-6,8,13H,3-4,7H2,1-2H3 |
| InChIKey | WKHXWPZSIXHQAS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |