C11H15NO3 — CID 43143422
N-ethyl-2-(2-hydroxyphenoxy)propanamide (PubChem CID 43143422) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is N-ethyl-2-(2-hydroxyphenoxy)propanamide.
| Compound Name | N-ethyl-2-(2-hydroxyphenoxy)propanamide |
|---|---|
| PubChem CID | 43143422 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | N-ethyl-2-(2-hydroxyphenoxy)propanamide |
| SMILES | CCNC(=O)C(C)Oc1ccccc1O |
| InChI | InChI=1S/C11H15NO3/c1-3-12-11(14)8(2)15-10-7-5-4-6-9(10)13/h4-8,13H,3H2,1-2H3,(H,12,14) |
| InChIKey | BJDFJMRYAAMYTJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |