C15H17NO3 — CID 43143635
2-(7-hydroxynaphthalen-2-yl)oxy-N,N-dimethylpropanamide (PubChem CID 43143635) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-(7-hydroxynaphthalen-2-yl)oxy-N,N-dimethylpropanamide.
| Compound Name | 2-(7-hydroxynaphthalen-2-yl)oxy-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 43143635 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-(7-hydroxynaphthalen-2-yl)oxy-N,N-dimethylpropanamide |
| SMILES | CC(Oc1ccc2ccc(O)cc2c1)C(=O)N(C)C |
| InChI | InChI=1S/C15H17NO3/c1-10(15(18)16(2)3)19-14-7-5-11-4-6-13(17)8-12(11)9-14/h4-10,17H,1-3H3 |
| InChIKey | GAPFNBLPFAHSAF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |