About (7-bromo-1,3-benzodioxol-5-yl)methanamine
(7-bromo-1,3-benzodioxol-5-yl)methanamine (PubChem CID 43143793) has the molecular formula C8H8BrNO2
and a molecular weight of 230.06 g/mol. Its IUPAC name is (7-bromo-1,3-benzodioxol-5-yl)methanamine.
Molecular Properties
| Compound Name | (7-bromo-1,3-benzodioxol-5-yl)methanamine |
| PubChem CID | 43143793 |
| Molecular Formula | C8H8BrNO2 |
| Molecular Weight | 230.06 g/mol |
| Exact Mass | 228.97 |
| IUPAC Name | (7-bromo-1,3-benzodioxol-5-yl)methanamine |
| SMILES | NCc1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C8H8BrNO2/c9-6-1-5(3-10)2-7-8(6)12-4-11-7/h1-2H,3-4,10H2 |
| InChIKey | ZIQQORINAWIECM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.06 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7-bromo-1,3-benzodioxol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-bromo-1,3-benzodioxol-5-yl)methanamine?
The IUPAC name of (7-bromo-1,3-benzodioxol-5-yl)methanamine (CID 43143793) is (7-bromo-1,3-benzodioxol-5-yl)methanamine.
What is the SMILES notation for (7-bromo-1,3-benzodioxol-5-yl)methanamine?
The canonical SMILES for (7-bromo-1,3-benzodioxol-5-yl)methanamine is NCc1cc(Br)c2c(c1)OCO2.
What is the InChIKey of (7-bromo-1,3-benzodioxol-5-yl)methanamine?
The InChIKey is ZIQQORINAWIECM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO2/c9-6-1-5(3-10)2-7-8(6)12-4-11-7/h1-2H,3-4,10H2.
What are the key properties of (7-bromo-1,3-benzodioxol-5-yl)methanamine?
(7-bromo-1,3-benzodioxol-5-yl)methanamine has a molecular weight of 230.06 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-bromo-1,3-benzodioxol-5-yl)methanamine is sourced from PubChem (CID 43143793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).