C9H8Br2O2 — CID 43143965
5-bromo-7-(bromomethyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 43143965) has the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. Its IUPAC name is 5-bromo-7-(bromomethyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 5-bromo-7-(bromomethyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 43143965 |
| Molecular Formula | C9H8Br2O2 |
| Molecular Weight | 307.97 g/mol |
| Exact Mass | 305.89 |
| IUPAC Name | 5-bromo-7-(bromomethyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | BrCc1cc(Br)c2c(c1)OCCO2 |
| InChI | InChI=1S/C9H8Br2O2/c10-5-6-3-7(11)9-8(4-6)12-1-2-13-9/h3-4H,1-2,5H2 |
| InChIKey | DOSWCANPVDUWQY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.97 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|