C12H12ClNO3 — CID 43144202
2-(chloromethyl)-5-(2,5-dimethoxyphenyl)-1,3-oxazole (PubChem CID 43144202) has the molecular formula C12H12ClNO3 and a molecular weight of 253.69 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(2,5-dimethoxyphenyl)-1,3-oxazole.
| Compound Name | 2-(chloromethyl)-5-(2,5-dimethoxyphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 43144202 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 2-(chloromethyl)-5-(2,5-dimethoxyphenyl)-1,3-oxazole |
| SMILES | COc1ccc(OC)c(-c2cnc(CCl)o2)c1 |
| InChI | InChI=1S/C12H12ClNO3/c1-15-8-3-4-10(16-2)9(5-8)11-7-14-12(6-13)17-11/h3-5,7H,6H2,1-2H3 |
| InChIKey | MHVPCEMFOSNQAY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|