About 6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine
6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 43144393) has the molecular formula C8H7ClN4
and a molecular weight of 194.62 g/mol. Its IUPAC name is 6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine.
Molecular Properties
| Compound Name | 6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine |
| PubChem CID | 43144393 |
| Molecular Formula | C8H7ClN4 |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | Clc1ccc2nnc(C3CC3)n2n1 |
| InChI | InChI=1S/C8H7ClN4/c9-6-3-4-7-10-11-8(5-1-2-5)13(7)12-6/h3-5H,1-2H2 |
| InChIKey | VJYULOBBCNCMJY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine?
The IUPAC name of 6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine (CID 43144393) is 6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine.
What is the SMILES notation for 6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine?
The canonical SMILES for 6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine is Clc1ccc2nnc(C3CC3)n2n1.
What is the InChIKey of 6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine?
The InChIKey is VJYULOBBCNCMJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN4/c9-6-3-4-7-10-11-8(5-1-2-5)13(7)12-6/h3-5H,1-2H2.
What are the key properties of 6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine?
6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine has a molecular weight of 194.62 g/mol, XLogP of 1.66, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazine is sourced from PubChem (CID 43144393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).