3-(4,6-dimethyl-2-oxo-1-pentan-2-ylpyrimidin-5-yl)propanoic acid

C14H22N2O3 — CID 43145186

IUPAC3-(4,6-dimethyl-2-oxo-1-pentan-2-ylpyrimidin-5-yl)propanoic acid
SMILESCCCC(C)n1c(C)c(CCC(=O)O)c(C)nc1=O
InChIInChI=1S/C14H22N2O3/c1-5-6-9(2)16-11(4)12(7-8-13(17)18)10(3)15-14(16)19/h9H,5-8H2,1-4H3,(H,17,18)
InChIKeyOYVTVFDIGUXBGE-UHFFFAOYSA-N
MW266.34 g/mol
LogP2.24
Rot. Bonds6

About 3-(4,6-dimethyl-2-oxo-1-pentan-2-ylpyrimidin-5-yl)propanoic acid

3-(4,6-dimethyl-2-oxo-1-pentan-2-ylpyrimidin-5-yl)propanoic acid (PubChem CID 43145186) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-(4,6-dimethyl-2-oxo-1-pentan-2-ylpyrimidin-5-yl)propanoic acid.

Molecular Properties

Compound Name3-(4,6-dimethyl-2-oxo-1-pentan-2-ylpyrimidin-5-yl)propanoic acid
PubChem CID43145186
Molecular FormulaC14H22N2O3
Molecular Weight266.34 g/mol
Exact Mass266.16
IUPAC Name3-(4,6-dimethyl-2-oxo-1-pentan-2-ylpyrimidin-5-yl)propanoic acid
SMILESCCCC(C)n1c(C)c(CCC(=O)O)c(C)nc1=O
InChIInChI=1S/C14H22N2O3/c1-5-6-9(2)16-11(4)12(7-8-13(17)18)10(3)15-14(16)19/h9H,5-8H2,1-4H3,(H,17,18)
InChIKeyOYVTVFDIGUXBGE-UHFFFAOYSA-N
XLogP2.24
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.34
LogP ≤ 52.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(4,6-dimethyl-2-oxo-1-pentan-2-ylpyrimidin-5-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4,6-dimethyl-2-oxo-1-pentan-2-ylpyrimidin-5-yl)propanoic acid?
The IUPAC name of 3-(4,6-dimethyl-2-oxo-1-pentan-2-ylpyrimidin-5-yl)propanoic acid (CID 43145186) is 3-(4,6-dimethyl-2-oxo-1-pentan-2-ylpyrimidin-5-yl)propanoic acid.
What is the SMILES notation for 3-(4,6-dimethyl-2-oxo-1-pentan-2-ylpyrimidin-5-yl)propanoic acid?
The canonical SMILES for 3-(4,6-dimethyl-2-oxo-1-pentan-2-ylpyrimidin-5-yl)propanoic acid is CCCC(C)n1c(C)c(CCC(=O)O)c(C)nc1=O.
What is the InChIKey of 3-(4,6-dimethyl-2-oxo-1-pentan-2-ylpyrimidin-5-yl)propanoic acid?
The InChIKey is OYVTVFDIGUXBGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O3/c1-5-6-9(2)16-11(4)12(7-8-13(17)18)10(3)15-14(16)19/h9H,5-8H2,1-4H3,(H,17,18).
What are the key properties of 3-(4,6-dimethyl-2-oxo-1-pentan-2-ylpyrimidin-5-yl)propanoic acid?
3-(4,6-dimethyl-2-oxo-1-pentan-2-ylpyrimidin-5-yl)propanoic acid has a molecular weight of 266.34 g/mol, XLogP of 2.24, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,6-dimethyl-2-oxo-1-pentan-2-ylpyrimidin-5-yl)propanoic acid is sourced from PubChem (CID 43145186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).