C12H13ClN2O2 — CID 43146117
N-(2-chloroacetyl)-2-methyl-2,3-dihydroindole-1-carboxamide (PubChem CID 43146117) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is N-(2-chloroacetyl)-2-methyl-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-(2-chloroacetyl)-2-methyl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 43146117 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-(2-chloroacetyl)-2-methyl-2,3-dihydroindole-1-carboxamide |
| SMILES | CC1Cc2ccccc2N1C(=O)NC(=O)CCl |
| InChI | InChI=1S/C12H13ClN2O2/c1-8-6-9-4-2-3-5-10(9)15(8)12(17)14-11(16)7-13/h2-5,8H,6-7H2,1H3,(H,14,16,17) |
| InChIKey | WJPKPSWGSYLLNI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|