About 1-N-(3-chloropropanoyl)piperidine-1,3-dicarboxamide
1-N-(3-chloropropanoyl)piperidine-1,3-dicarboxamide (PubChem CID 43146141) has the molecular formula C10H16ClN3O3
and a molecular weight of 261.71 g/mol. Its IUPAC name is 1-N-(3-chloropropanoyl)piperidine-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 1-N-(3-chloropropanoyl)piperidine-1,3-dicarboxamide |
| PubChem CID | 43146141 |
| Molecular Formula | C10H16ClN3O3 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 1-N-(3-chloropropanoyl)piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)C1CCCN(C(=O)NC(=O)CCCl)C1 |
| InChI | InChI=1S/C10H16ClN3O3/c11-4-3-8(15)13-10(17)14-5-1-2-7(6-14)9(12)16/h7H,1-6H2,(H2,12,16)(H,13,15,17) |
| InChIKey | LDTIXTIEYCNUQC-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-N-(3-chloropropanoyl)piperidine-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(3-chloropropanoyl)piperidine-1,3-dicarboxamide?
The IUPAC name of 1-N-(3-chloropropanoyl)piperidine-1,3-dicarboxamide (CID 43146141) is 1-N-(3-chloropropanoyl)piperidine-1,3-dicarboxamide.
What is the SMILES notation for 1-N-(3-chloropropanoyl)piperidine-1,3-dicarboxamide?
The canonical SMILES for 1-N-(3-chloropropanoyl)piperidine-1,3-dicarboxamide is NC(=O)C1CCCN(C(=O)NC(=O)CCCl)C1.
What is the InChIKey of 1-N-(3-chloropropanoyl)piperidine-1,3-dicarboxamide?
The InChIKey is LDTIXTIEYCNUQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClN3O3/c11-4-3-8(15)13-10(17)14-5-1-2-7(6-14)9(12)16/h7H,1-6H2,(H2,12,16)(H,13,15,17).
What are the key properties of 1-N-(3-chloropropanoyl)piperidine-1,3-dicarboxamide?
1-N-(3-chloropropanoyl)piperidine-1,3-dicarboxamide has a molecular weight of 261.71 g/mol, XLogP of 0.05, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(3-chloropropanoyl)piperidine-1,3-dicarboxamide is sourced from PubChem (CID 43146141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).