C12H15ClN2O3 — CID 43146435
2-chloro-N-[(4-propan-2-yloxyphenyl)carbamoyl]acetamide (PubChem CID 43146435) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 2-chloro-N-[(4-propan-2-yloxyphenyl)carbamoyl]acetamide.
| Compound Name | 2-chloro-N-[(4-propan-2-yloxyphenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 43146435 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-chloro-N-[(4-propan-2-yloxyphenyl)carbamoyl]acetamide |
| SMILES | CC(C)Oc1ccc(NC(=O)NC(=O)CCl)cc1 |
| InChI | InChI=1S/C12H15ClN2O3/c1-8(2)18-10-5-3-9(4-6-10)14-12(17)15-11(16)7-13/h3-6,8H,7H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | UDFGAJOKNNNTHB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|