About 4-methoxy-4-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine
4-methoxy-4-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine (PubChem CID 43146950) has the molecular formula C9H18F3NO
and a molecular weight of 213.24 g/mol. Its IUPAC name is 4-methoxy-4-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine.
Molecular Properties
| Compound Name | 4-methoxy-4-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine |
| PubChem CID | 43146950 |
| Molecular Formula | C9H18F3NO |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 4-methoxy-4-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine |
| SMILES | COC(C)(C)CC(C)NCC(F)(F)F |
| InChI | InChI=1S/C9H18F3NO/c1-7(5-8(2,3)14-4)13-6-9(10,11)12/h7,13H,5-6H2,1-4H3 |
| InChIKey | HZUIAVGMSIZKIX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-4-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-4-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine?
The IUPAC name of 4-methoxy-4-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine (CID 43146950) is 4-methoxy-4-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine.
What is the SMILES notation for 4-methoxy-4-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine?
The canonical SMILES for 4-methoxy-4-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine is COC(C)(C)CC(C)NCC(F)(F)F.
What is the InChIKey of 4-methoxy-4-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine?
The InChIKey is HZUIAVGMSIZKIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3NO/c1-7(5-8(2,3)14-4)13-6-9(10,11)12/h7,13H,5-6H2,1-4H3.
What are the key properties of 4-methoxy-4-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine?
4-methoxy-4-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine has a molecular weight of 213.24 g/mol, XLogP of 2.34, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-4-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine is sourced from PubChem (CID 43146950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).