About 2-[(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)amino]benzonitrile
2-[(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)amino]benzonitrile (PubChem CID 43147361) has the molecular formula C19H20N2
and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-[(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)amino]benzonitrile.
Molecular Properties
| Compound Name | 2-[(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)amino]benzonitrile |
| PubChem CID | 43147361 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-[(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)amino]benzonitrile |
| SMILES | CC1(C)CCC(Nc2ccccc2C#N)c2ccccc21 |
| InChI | InChI=1S/C19H20N2/c1-19(2)12-11-18(15-8-4-5-9-16(15)19)21-17-10-6-3-7-14(17)13-20/h3-10,18,21H,11-12H2,1-2H3 |
| InChIKey | BZGOACVTQUMGRB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)amino]benzonitrile?
The IUPAC name of 2-[(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)amino]benzonitrile (CID 43147361) is 2-[(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)amino]benzonitrile.
What is the SMILES notation for 2-[(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)amino]benzonitrile?
The canonical SMILES for 2-[(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)amino]benzonitrile is CC1(C)CCC(Nc2ccccc2C#N)c2ccccc21.
What is the InChIKey of 2-[(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)amino]benzonitrile?
The InChIKey is BZGOACVTQUMGRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2/c1-19(2)12-11-18(15-8-4-5-9-16(15)19)21-17-10-6-3-7-14(17)13-20/h3-10,18,21H,11-12H2,1-2H3.
What are the key properties of 2-[(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)amino]benzonitrile?
2-[(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)amino]benzonitrile has a molecular weight of 276.38 g/mol, XLogP of 4.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)amino]benzonitrile is sourced from PubChem (CID 43147361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).