About 4,4,4-trifluoro-1-(2-nitrophenyl)butane-1,3-dione
4,4,4-trifluoro-1-(2-nitrophenyl)butane-1,3-dione (PubChem CID 43147556) has the molecular formula C10H6F3NO4
and a molecular weight of 261.15 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(2-nitrophenyl)butane-1,3-dione.
Molecular Properties
| Compound Name | 4,4,4-trifluoro-1-(2-nitrophenyl)butane-1,3-dione |
| PubChem CID | 43147556 |
| Molecular Formula | C10H6F3NO4 |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 4,4,4-trifluoro-1-(2-nitrophenyl)butane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)F)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H6F3NO4/c11-10(12,13)9(16)5-8(15)6-3-1-2-4-7(6)14(17)18/h1-4H,5H2 |
| InChIKey | ONQLWSTWOUGITA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,4,4-trifluoro-1-(2-nitrophenyl)butane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4,4-trifluoro-1-(2-nitrophenyl)butane-1,3-dione?
The IUPAC name of 4,4,4-trifluoro-1-(2-nitrophenyl)butane-1,3-dione (CID 43147556) is 4,4,4-trifluoro-1-(2-nitrophenyl)butane-1,3-dione.
What is the SMILES notation for 4,4,4-trifluoro-1-(2-nitrophenyl)butane-1,3-dione?
The canonical SMILES for 4,4,4-trifluoro-1-(2-nitrophenyl)butane-1,3-dione is O=C(CC(=O)C(F)(F)F)c1ccccc1[N+](=O)[O-].
What is the InChIKey of 4,4,4-trifluoro-1-(2-nitrophenyl)butane-1,3-dione?
The InChIKey is ONQLWSTWOUGITA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F3NO4/c11-10(12,13)9(16)5-8(15)6-3-1-2-4-7(6)14(17)18/h1-4H,5H2.
What are the key properties of 4,4,4-trifluoro-1-(2-nitrophenyl)butane-1,3-dione?
4,4,4-trifluoro-1-(2-nitrophenyl)butane-1,3-dione has a molecular weight of 261.15 g/mol, XLogP of 2.30, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4,4-trifluoro-1-(2-nitrophenyl)butane-1,3-dione is sourced from PubChem (CID 43147556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).