C9H14N2O2S — CID 43148507
2-(1-butan-2-ylimidazol-2-yl)sulfanylacetic acid (PubChem CID 43148507) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-(1-butan-2-ylimidazol-2-yl)sulfanylacetic acid.
| Compound Name | 2-(1-butan-2-ylimidazol-2-yl)sulfanylacetic acid |
|---|---|
| PubChem CID | 43148507 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-(1-butan-2-ylimidazol-2-yl)sulfanylacetic acid |
| SMILES | CCC(C)n1ccnc1SCC(=O)O |
| InChI | InChI=1S/C9H14N2O2S/c1-3-7(2)11-5-4-10-9(11)14-6-8(12)13/h4-5,7H,3,6H2,1-2H3,(H,12,13) |
| InChIKey | YCHOVCNVCZMCNZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |