About 2-[(4-pentan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid
2-[(4-pentan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid (PubChem CID 43148548) has the molecular formula C9H15N3O2S
and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-[(4-pentan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid.
Molecular Properties
| Compound Name | 2-[(4-pentan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid |
| PubChem CID | 43148548 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-[(4-pentan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid |
| SMILES | CCCC(C)n1cnnc1SCC(=O)O |
| InChI | InChI=1S/C9H15N3O2S/c1-3-4-7(2)12-6-10-11-9(12)15-5-8(13)14/h6-7H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | YHPAJAXEEPGEPE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-pentan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-pentan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid?
The IUPAC name of 2-[(4-pentan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid (CID 43148548) is 2-[(4-pentan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid.
What is the SMILES notation for 2-[(4-pentan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid?
The canonical SMILES for 2-[(4-pentan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid is CCCC(C)n1cnnc1SCC(=O)O.
What is the InChIKey of 2-[(4-pentan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid?
The InChIKey is YHPAJAXEEPGEPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2S/c1-3-4-7(2)12-6-10-11-9(12)15-5-8(13)14/h6-7H,3-5H2,1-2H3,(H,13,14).
What are the key properties of 2-[(4-pentan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid?
2-[(4-pentan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid has a molecular weight of 229.30 g/mol, XLogP of 1.82, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-pentan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetic acid is sourced from PubChem (CID 43148548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).