C16H18BrNO3 — CID 43149051
(5-bromo-2-methoxyphenyl)-(3,5-dimethoxyphenyl)methanamine (PubChem CID 43149051) has the molecular formula C16H18BrNO3 and a molecular weight of 352.23 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)-(3,5-dimethoxyphenyl)methanamine.
| Compound Name | (5-bromo-2-methoxyphenyl)-(3,5-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 43149051 |
| Molecular Formula | C16H18BrNO3 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)-(3,5-dimethoxyphenyl)methanamine |
| SMILES | COc1cc(OC)cc(C(N)c2cc(Br)ccc2OC)c1 |
| InChI | InChI=1S/C16H18BrNO3/c1-19-12-6-10(7-13(9-12)20-2)16(18)14-8-11(17)4-5-15(14)21-3/h4-9,16H,18H2,1-3H3 |
| InChIKey | KDYVTFBJFZMXOG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |