C8H10N4OS — CID 43149283
4-amino-3-(2,5-dimethylfuran-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 43149283) has the molecular formula C8H10N4OS and a molecular weight of 210.26 g/mol. Its IUPAC name is 4-amino-3-(2,5-dimethylfuran-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-(2,5-dimethylfuran-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 43149283 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 4-amino-3-(2,5-dimethylfuran-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(-c2n[nH]c(=S)n2N)c(C)o1 |
| InChI | InChI=1S/C8H10N4OS/c1-4-3-6(5(2)13-4)7-10-11-8(14)12(7)9/h3H,9H2,1-2H3,(H,11,14) |
| InChIKey | WXRZASCOMCCEDE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|