About N-(oxolan-2-ylmethyl)-N'-[(4-propan-2-ylphenyl)methyl]oxamide
N-(oxolan-2-ylmethyl)-N'-[(4-propan-2-ylphenyl)methyl]oxamide (PubChem CID 4314957) has the molecular formula C17H24N2O3
and a molecular weight of 304.39 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-N'-[(4-propan-2-ylphenyl)methyl]oxamide.
Molecular Properties
| Compound Name | N-(oxolan-2-ylmethyl)-N'-[(4-propan-2-ylphenyl)methyl]oxamide |
| PubChem CID | 4314957 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-N'-[(4-propan-2-ylphenyl)methyl]oxamide |
| SMILES | CC(C)c1ccc(CNC(=O)C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C17H24N2O3/c1-12(2)14-7-5-13(6-8-14)10-18-16(20)17(21)19-11-15-4-3-9-22-15/h5-8,12,15H,3-4,9-11H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | NUXLBINQNRXXCR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(oxolan-2-ylmethyl)-N'-[(4-propan-2-ylphenyl)methyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxolan-2-ylmethyl)-N'-[(4-propan-2-ylphenyl)methyl]oxamide?
The IUPAC name of N-(oxolan-2-ylmethyl)-N'-[(4-propan-2-ylphenyl)methyl]oxamide (CID 4314957) is N-(oxolan-2-ylmethyl)-N'-[(4-propan-2-ylphenyl)methyl]oxamide.
What is the SMILES notation for N-(oxolan-2-ylmethyl)-N'-[(4-propan-2-ylphenyl)methyl]oxamide?
The canonical SMILES for N-(oxolan-2-ylmethyl)-N'-[(4-propan-2-ylphenyl)methyl]oxamide is CC(C)c1ccc(CNC(=O)C(=O)NCC2CCCO2)cc1.
What is the InChIKey of N-(oxolan-2-ylmethyl)-N'-[(4-propan-2-ylphenyl)methyl]oxamide?
The InChIKey is NUXLBINQNRXXCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O3/c1-12(2)14-7-5-13(6-8-14)10-18-16(20)17(21)19-11-15-4-3-9-22-15/h5-8,12,15H,3-4,9-11H2,1-2H3,(H,18,20)(H,19,21).
What are the key properties of N-(oxolan-2-ylmethyl)-N'-[(4-propan-2-ylphenyl)methyl]oxamide?
N-(oxolan-2-ylmethyl)-N'-[(4-propan-2-ylphenyl)methyl]oxamide has a molecular weight of 304.39 g/mol, XLogP of 1.72, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxolan-2-ylmethyl)-N'-[(4-propan-2-ylphenyl)methyl]oxamide is sourced from PubChem (CID 4314957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).