C11H11N5O3 — CID 43150095
6-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 43150095) has the molecular formula C11H11N5O3 and a molecular weight of 261.24 g/mol. Its IUPAC name is 6-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 43150095 |
| Molecular Formula | C11H11N5O3 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 6-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1c1nc(-c2ncn[nH]2)no1 |
| InChI | InChI=1S/C11H11N5O3/c17-11(18)7-4-2-1-3-6(7)10-14-9(16-19-10)8-12-5-13-15-8/h1-2,5-7H,3-4H2,(H,17,18)(H,12,13,15) |
| InChIKey | NMBRRYQJNFQESW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|