About Ethyl 4-{[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl}piperazine-1-carboxylate
Ethyl 4-{[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl}piperazine-1-carboxylate (PubChem CID 4315024) has the molecular formula C23H29N3O6S
and a molecular weight of 475.60 g/mol. Its IUPAC name is ethyl 4-[2-[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | Ethyl 4-{[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl}piperazine-1-carboxylate |
| PubChem CID | 4315024 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | ethyl 4-[2-[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC1)C(=O)COC2=C(C=C(C=C2)S(=O)(=O)NCC3=CC=CC=C3)C |
| InChI | InChI=1S/C23H29N3O6S/c1-3-31-23(28)26-13-11-25(12-14-26)22(27)17-32-21-10-9-20(15-18(21)2)33(29,30)24-16-19-7-5-4-6-8-19/h4-10,15,24H,3,11-14,16-17H2,1-2H3 |
| InChIKey | XJJNXLDHOTVINC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | 742 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze Ethyl 4-{[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl}piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethyl 4-{[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl}piperazine-1-carboxylate?
The IUPAC name of Ethyl 4-{[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl}piperazine-1-carboxylate (CID 4315024) is ethyl 4-[2-[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl]piperazine-1-carboxylate.
What is the SMILES notation for Ethyl 4-{[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl}piperazine-1-carboxylate?
The canonical SMILES for Ethyl 4-{[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl}piperazine-1-carboxylate is CCOC(=O)N1CCN(CC1)C(=O)COC2=C(C=C(C=C2)S(=O)(=O)NCC3=CC=CC=C3)C.
What is the InChIKey of Ethyl 4-{[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl}piperazine-1-carboxylate?
The InChIKey is XJJNXLDHOTVINC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29N3O6S/c1-3-31-23(28)26-13-11-25(12-14-26)22(27)17-32-21-10-9-20(15-18(21)2)33(29,30)24-16-19-7-5-4-6-8-19/h4-10,15,24H,3,11-14,16-17H2,1-2H3.
What are the key properties of Ethyl 4-{[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl}piperazine-1-carboxylate?
Ethyl 4-{[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl}piperazine-1-carboxylate has a molecular weight of 475.60 g/mol, XLogP of 2.30, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Ethyl 4-{[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl}piperazine-1-carboxylate is sourced from PubChem (CID 4315024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).