C23H29N3O6S — CID 4315024
ethyl 4-[2-[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl]piperazine-1-carboxylate (PubChem CID 4315024) has the molecular formula C23H29N3O6S and a molecular weight of 475.57 g/mol. Its IUPAC name is ethyl 4-[2-[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 4315024 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | ethyl 4-[2-[4-(benzylsulfamoyl)-2-methylphenoxy]acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)COc2ccc(S(=O)(=O)NCc3ccccc3)cc2C)CC1 |
| InChI | InChI=1S/C23H29N3O6S/c1-3-31-23(28)26-13-11-25(12-14-26)22(27)17-32-21-10-9-20(15-18(21)2)33(29,30)24-16-19-7-5-4-6-8-19/h4-10,15,24H,3,11-14,16-17H2,1-2H3 |
| InChIKey | XJJNXLDHOTVINC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |