C10H6ClF2N3 — CID 43151751
6-chloro-N-(3,4-difluorophenyl)pyridazin-3-amine (PubChem CID 43151751) has the molecular formula C10H6ClF2N3 and a molecular weight of 241.63 g/mol. Its IUPAC name is 6-chloro-N-(3,4-difluorophenyl)pyridazin-3-amine.
| Compound Name | 6-chloro-N-(3,4-difluorophenyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 43151751 |
| Molecular Formula | C10H6ClF2N3 |
| Molecular Weight | 241.63 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 6-chloro-N-(3,4-difluorophenyl)pyridazin-3-amine |
| SMILES | Fc1ccc(Nc2ccc(Cl)nn2)cc1F |
| InChI | InChI=1S/C10H6ClF2N3/c11-9-3-4-10(16-15-9)14-6-1-2-7(12)8(13)5-6/h1-5H,(H,14,16) |
| InChIKey | VQEIGTMAGATHEX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.63 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |