C24H26F6N2O2 — CID 4315259
4-[2-(3,4-diethoxyphenyl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 4315259) has the molecular formula C24H26F6N2O2 and a molecular weight of 488.47 g/mol. Its IUPAC name is 4-[2-(3,4-diethoxyphenyl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(3,4-diethoxyphenyl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4315259 |
| Molecular Formula | C24H26F6N2O2 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 4-[2-(3,4-diethoxyphenyl)-4,6-bis(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | CCOc1ccc(-c2[nH]c3cc(C(F)(F)F)cc(C(F)(F)F)c3c2CCCCN)cc1OCC |
| InChI | InChI=1S/C24H26F6N2O2/c1-3-33-19-9-8-14(11-20(19)34-4-2)22-16(7-5-6-10-31)21-17(24(28,29)30)12-15(23(25,26)27)13-18(21)32-22/h8-9,11-13,32H,3-7,10,31H2,1-2H3 |
| InChIKey | ZEPIRYDSIRWHIO-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|