C10H12FNO — CID 43153235
9-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine (PubChem CID 43153235) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is 9-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine.
| Compound Name | 9-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
|---|---|
| PubChem CID | 43153235 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 9-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
| SMILES | NC1CCCOc2c(F)cccc21 |
| InChI | InChI=1S/C10H12FNO/c11-8-4-1-3-7-9(12)5-2-6-13-10(7)8/h1,3-4,9H,2,5-6,12H2 |
| InChIKey | RABQNHWEZGFKCN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |