C12H11F3N4S — CID 43153739
2-(1-methylimidazol-2-yl)sulfanyl-5-(trifluoromethyl)benzenecarboximidamide (PubChem CID 43153739) has the molecular formula C12H11F3N4S and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)sulfanyl-5-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | 2-(1-methylimidazol-2-yl)sulfanyl-5-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 43153739 |
| Molecular Formula | C12H11F3N4S |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)sulfanyl-5-(trifluoromethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C(F)(F)F)ccc1Sc1nccn1C |
| InChI | InChI=1S/C12H11F3N4S/c1-19-5-4-18-11(19)20-9-3-2-7(12(13,14)15)6-8(9)10(16)17/h2-6H,1H3,(H3,16,17) |
| InChIKey | MLHRYLXQOIZIAM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|