C16H16OS — CID 43154038
cyclopropyl-[5-(2,3-dimethylphenyl)thiophen-2-yl]methanone (PubChem CID 43154038) has the molecular formula C16H16OS and a molecular weight of 256.37 g/mol. Its IUPAC name is cyclopropyl-[5-(2,3-dimethylphenyl)thiophen-2-yl]methanone.
| Compound Name | cyclopropyl-[5-(2,3-dimethylphenyl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 43154038 |
| Molecular Formula | C16H16OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | cyclopropyl-[5-(2,3-dimethylphenyl)thiophen-2-yl]methanone |
| SMILES | Cc1cccc(-c2ccc(C(=O)C3CC3)s2)c1C |
| InChI | InChI=1S/C16H16OS/c1-10-4-3-5-13(11(10)2)14-8-9-15(18-14)16(17)12-6-7-12/h3-5,8-9,12H,6-7H2,1-2H3 |
| InChIKey | DHQRDWLZEPKWJQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |