C20H18ClN5O4 — CID 4315437
3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(4-nitrophenyl)piperidine-1-carboxamide (PubChem CID 4315437) has the molecular formula C20H18ClN5O4 and a molecular weight of 427.85 g/mol. Its IUPAC name is 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(4-nitrophenyl)piperidine-1-carboxamide.
| Compound Name | 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(4-nitrophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 4315437 |
| Molecular Formula | C20H18ClN5O4 |
| Molecular Weight | 427.85 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(4-nitrophenyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)N1CCCC(c2nc(-c3ccc(Cl)cc3)no2)C1 |
| InChI | InChI=1S/C20H18ClN5O4/c21-15-5-3-13(4-6-15)18-23-19(30-24-18)14-2-1-11-25(12-14)20(27)22-16-7-9-17(10-8-16)26(28)29/h3-10,14H,1-2,11-12H2,(H,22,27) |
| InChIKey | ZCCSJSAFTHEMTN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.85 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|