C10H11NO3 — CID 43155060
7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-8-amine (PubChem CID 43155060) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-8-amine.
| Compound Name | 7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-8-amine |
|---|---|
| PubChem CID | 43155060 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-8-amine |
| SMILES | NC1CCOc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C10H11NO3/c11-7-1-2-12-8-4-10-9(3-6(7)8)13-5-14-10/h3-4,7H,1-2,5,11H2 |
| InChIKey | WVDGCAFJUJGSGF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |