About 1,1-dioxo-7-propan-2-yl-3,4-dihydro-2H-1λ6-benzothiepin-5-one
1,1-dioxo-7-propan-2-yl-3,4-dihydro-2H-1λ6-benzothiepin-5-one (PubChem CID 43155220) has the molecular formula C13H16O3S
and a molecular weight of 252.33 g/mol. Its IUPAC name is 1,1-dioxo-7-propan-2-yl-3,4-dihydro-2H-1λ6-benzothiepin-5-one.
Molecular Properties
| Compound Name | 1,1-dioxo-7-propan-2-yl-3,4-dihydro-2H-1λ6-benzothiepin-5-one |
| PubChem CID | 43155220 |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 1,1-dioxo-7-propan-2-yl-3,4-dihydro-2H-1λ6-benzothiepin-5-one |
| SMILES | CC(C)c1ccc2c(c1)C(=O)CCCS2(=O)=O |
| InChI | InChI=1S/C13H16O3S/c1-9(2)10-5-6-13-11(8-10)12(14)4-3-7-17(13,15)16/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | ZQLQBHBGENAADG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1-dioxo-7-propan-2-yl-3,4-dihydro-2H-1λ6-benzothiepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-7-propan-2-yl-3,4-dihydro-2H-1λ6-benzothiepin-5-one?
The IUPAC name of 1,1-dioxo-7-propan-2-yl-3,4-dihydro-2H-1λ6-benzothiepin-5-one (CID 43155220) is 1,1-dioxo-7-propan-2-yl-3,4-dihydro-2H-1λ6-benzothiepin-5-one.
What is the SMILES notation for 1,1-dioxo-7-propan-2-yl-3,4-dihydro-2H-1λ6-benzothiepin-5-one?
The canonical SMILES for 1,1-dioxo-7-propan-2-yl-3,4-dihydro-2H-1λ6-benzothiepin-5-one is CC(C)c1ccc2c(c1)C(=O)CCCS2(=O)=O.
What is the InChIKey of 1,1-dioxo-7-propan-2-yl-3,4-dihydro-2H-1λ6-benzothiepin-5-one?
The InChIKey is ZQLQBHBGENAADG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3S/c1-9(2)10-5-6-13-11(8-10)12(14)4-3-7-17(13,15)16/h5-6,8-9H,3-4,7H2,1-2H3.
What are the key properties of 1,1-dioxo-7-propan-2-yl-3,4-dihydro-2H-1λ6-benzothiepin-5-one?
1,1-dioxo-7-propan-2-yl-3,4-dihydro-2H-1λ6-benzothiepin-5-one has a molecular weight of 252.33 g/mol, XLogP of 2.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-7-propan-2-yl-3,4-dihydro-2H-1λ6-benzothiepin-5-one is sourced from PubChem (CID 43155220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).