C13H11F2NO2S — CID 43155562
ethyl 3-amino-5-(3,5-difluorophenyl)thiophene-2-carboxylate (PubChem CID 43155562) has the molecular formula C13H11F2NO2S and a molecular weight of 283.30 g/mol. Its IUPAC name is ethyl 3-amino-5-(3,5-difluorophenyl)thiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-5-(3,5-difluorophenyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 43155562 |
| Molecular Formula | C13H11F2NO2S |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | ethyl 3-amino-5-(3,5-difluorophenyl)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2cc(F)cc(F)c2)cc1N |
| InChI | InChI=1S/C13H11F2NO2S/c1-2-18-13(17)12-10(16)6-11(19-12)7-3-8(14)5-9(15)4-7/h3-6H,2,16H2,1H3 |
| InChIKey | GPTYBIFKIANEQD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |