About [5-(2,4,6-tribromophenyl)furan-2-yl]methanamine
[5-(2,4,6-tribromophenyl)furan-2-yl]methanamine (PubChem CID 43155894) has the molecular formula C11H8Br3NO
and a molecular weight of 409.90 g/mol. Its IUPAC name is [5-(2,4,6-tribromophenyl)furan-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-(2,4,6-tribromophenyl)furan-2-yl]methanamine |
| PubChem CID | 43155894 |
| Molecular Formula | C11H8Br3NO |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 406.82 |
| IUPAC Name | [5-(2,4,6-tribromophenyl)furan-2-yl]methanamine |
| SMILES | NCc1ccc(-c2c(Br)cc(Br)cc2Br)o1 |
| InChI | InChI=1S/C11H8Br3NO/c12-6-3-8(13)11(9(14)4-6)10-2-1-7(5-15)16-10/h1-4H,5,15H2 |
| InChIKey | RBYWKUPTEVJDMK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [5-(2,4,6-tribromophenyl)furan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,4,6-tribromophenyl)furan-2-yl]methanamine?
The IUPAC name of [5-(2,4,6-tribromophenyl)furan-2-yl]methanamine (CID 43155894) is [5-(2,4,6-tribromophenyl)furan-2-yl]methanamine.
What is the SMILES notation for [5-(2,4,6-tribromophenyl)furan-2-yl]methanamine?
The canonical SMILES for [5-(2,4,6-tribromophenyl)furan-2-yl]methanamine is NCc1ccc(-c2c(Br)cc(Br)cc2Br)o1.
What is the InChIKey of [5-(2,4,6-tribromophenyl)furan-2-yl]methanamine?
The InChIKey is RBYWKUPTEVJDMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Br3NO/c12-6-3-8(13)11(9(14)4-6)10-2-1-7(5-15)16-10/h1-4H,5,15H2.
What are the key properties of [5-(2,4,6-tribromophenyl)furan-2-yl]methanamine?
[5-(2,4,6-tribromophenyl)furan-2-yl]methanamine has a molecular weight of 409.90 g/mol, XLogP of 4.69, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,4,6-tribromophenyl)furan-2-yl]methanamine is sourced from PubChem (CID 43155894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).