About ethyl 1-[3-(1,3-benzothiazol-2-yl)propanoyl]piperidine-3-carboxylate
ethyl 1-[3-(1,3-benzothiazol-2-yl)propanoyl]piperidine-3-carboxylate (PubChem CID 4315591) has the molecular formula C18H22N2O3S
and a molecular weight of 346.45 g/mol. Its IUPAC name is ethyl 1-[3-(1,3-benzothiazol-2-yl)propanoyl]piperidine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[3-(1,3-benzothiazol-2-yl)propanoyl]piperidine-3-carboxylate |
| PubChem CID | 4315591 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | ethyl 1-[3-(1,3-benzothiazol-2-yl)propanoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)CCc2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C18H22N2O3S/c1-2-23-18(22)13-6-5-11-20(12-13)17(21)10-9-16-19-14-7-3-4-8-15(14)24-16/h3-4,7-8,13H,2,5-6,9-12H2,1H3 |
| InChIKey | UMNUNQBFHWVRCC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-[3-(1,3-benzothiazol-2-yl)propanoyl]piperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[3-(1,3-benzothiazol-2-yl)propanoyl]piperidine-3-carboxylate?
The IUPAC name of ethyl 1-[3-(1,3-benzothiazol-2-yl)propanoyl]piperidine-3-carboxylate (CID 4315591) is ethyl 1-[3-(1,3-benzothiazol-2-yl)propanoyl]piperidine-3-carboxylate.
What is the SMILES notation for ethyl 1-[3-(1,3-benzothiazol-2-yl)propanoyl]piperidine-3-carboxylate?
The canonical SMILES for ethyl 1-[3-(1,3-benzothiazol-2-yl)propanoyl]piperidine-3-carboxylate is CCOC(=O)C1CCCN(C(=O)CCc2nc3ccccc3s2)C1.
What is the InChIKey of ethyl 1-[3-(1,3-benzothiazol-2-yl)propanoyl]piperidine-3-carboxylate?
The InChIKey is UMNUNQBFHWVRCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O3S/c1-2-23-18(22)13-6-5-11-20(12-13)17(21)10-9-16-19-14-7-3-4-8-15(14)24-16/h3-4,7-8,13H,2,5-6,9-12H2,1H3.
What are the key properties of ethyl 1-[3-(1,3-benzothiazol-2-yl)propanoyl]piperidine-3-carboxylate?
ethyl 1-[3-(1,3-benzothiazol-2-yl)propanoyl]piperidine-3-carboxylate has a molecular weight of 346.45 g/mol, XLogP of 3.03, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[3-(1,3-benzothiazol-2-yl)propanoyl]piperidine-3-carboxylate is sourced from PubChem (CID 4315591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).