C7H15N3O2 — CID 43155944
(3Z)-3-amino-N,N-diethyl-3-hydroxyiminopropanamide (PubChem CID 43155944) has the molecular formula C7H15N3O2 and a molecular weight of 173.22 g/mol. Its IUPAC name is (3Z)-3-amino-N,N-diethyl-3-hydroxyiminopropanamide.
| Compound Name | (3Z)-3-amino-N,N-diethyl-3-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 43155944 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (3Z)-3-amino-N,N-diethyl-3-hydroxyiminopropanamide |
| SMILES | CCN(CC)C(=O)C/C(N)=N/O |
| InChI | InChI=1S/C7H15N3O2/c1-3-10(4-2)7(11)5-6(8)9-12/h12H,3-5H2,1-2H3,(H2,8,9) |
| InChIKey | WJSAICNRRWUWPQ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|