About (3Z)-3-amino-3-hydroxyimino-N,N-dipropylpropanamide
(3Z)-3-amino-3-hydroxyimino-N,N-dipropylpropanamide (PubChem CID 43156006) has the molecular formula C9H19N3O2
and a molecular weight of 201.27 g/mol. Its IUPAC name is (3Z)-3-amino-3-hydroxyimino-N,N-dipropylpropanamide.
Molecular Properties
| Compound Name | (3Z)-3-amino-3-hydroxyimino-N,N-dipropylpropanamide |
| PubChem CID | 43156006 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (3Z)-3-amino-3-hydroxyimino-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)C/C(N)=N/O |
| InChI | InChI=1S/C9H19N3O2/c1-3-5-12(6-4-2)9(13)7-8(10)11-14/h14H,3-7H2,1-2H3,(H2,10,11) |
| InChIKey | RUAFEZFZGNXGAW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-amino-3-hydroxyimino-N,N-dipropylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-amino-3-hydroxyimino-N,N-dipropylpropanamide?
The IUPAC name of (3Z)-3-amino-3-hydroxyimino-N,N-dipropylpropanamide (CID 43156006) is (3Z)-3-amino-3-hydroxyimino-N,N-dipropylpropanamide.
What is the SMILES notation for (3Z)-3-amino-3-hydroxyimino-N,N-dipropylpropanamide?
The canonical SMILES for (3Z)-3-amino-3-hydroxyimino-N,N-dipropylpropanamide is CCCN(CCC)C(=O)C/C(N)=N/O.
What is the InChIKey of (3Z)-3-amino-3-hydroxyimino-N,N-dipropylpropanamide?
The InChIKey is RUAFEZFZGNXGAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O2/c1-3-5-12(6-4-2)9(13)7-8(10)11-14/h14H,3-7H2,1-2H3,(H2,10,11).
What are the key properties of (3Z)-3-amino-3-hydroxyimino-N,N-dipropylpropanamide?
(3Z)-3-amino-3-hydroxyimino-N,N-dipropylpropanamide has a molecular weight of 201.27 g/mol, XLogP of 0.77, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-amino-3-hydroxyimino-N,N-dipropylpropanamide is sourced from PubChem (CID 43156006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).