2-(2,6-dichlorophenyl)-1,3-thiazole-5-carboxylic acid

C10H5Cl2NO2S — CID 43156441

IUPAC2-(2,6-dichlorophenyl)-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(-c2c(Cl)cccc2Cl)s1
InChIInChI=1S/C10H5Cl2NO2S/c11-5-2-1-3-6(12)8(5)9-13-4-7(16-9)10(14)15/h1-4H,(H,14,15)
InChIKeyCYAQBLXUIKZTRB-UHFFFAOYSA-N
MW274.13 g/mol
LogP3.82
Rot. Bonds2

About 2-(2,6-dichlorophenyl)-1,3-thiazole-5-carboxylic acid

2-(2,6-dichlorophenyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 43156441) has the molecular formula C10H5Cl2NO2S and a molecular weight of 274.13 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(2,6-dichlorophenyl)-1,3-thiazole-5-carboxylic acid
PubChem CID43156441
Molecular FormulaC10H5Cl2NO2S
Molecular Weight274.13 g/mol
Exact Mass272.94
IUPAC Name2-(2,6-dichlorophenyl)-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(-c2c(Cl)cccc2Cl)s1
InChIInChI=1S/C10H5Cl2NO2S/c11-5-2-1-3-6(12)8(5)9-13-4-7(16-9)10(14)15/h1-4H,(H,14,15)
InChIKeyCYAQBLXUIKZTRB-UHFFFAOYSA-N
XLogP3.82
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.13
LogP ≤ 53.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2,6-dichlorophenyl)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,6-dichlorophenyl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(2,6-dichlorophenyl)-1,3-thiazole-5-carboxylic acid (CID 43156441) is 2-(2,6-dichlorophenyl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(2,6-dichlorophenyl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(2,6-dichlorophenyl)-1,3-thiazole-5-carboxylic acid is O=C(O)c1cnc(-c2c(Cl)cccc2Cl)s1.
What is the InChIKey of 2-(2,6-dichlorophenyl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is CYAQBLXUIKZTRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Cl2NO2S/c11-5-2-1-3-6(12)8(5)9-13-4-7(16-9)10(14)15/h1-4H,(H,14,15).
What are the key properties of 2-(2,6-dichlorophenyl)-1,3-thiazole-5-carboxylic acid?
2-(2,6-dichlorophenyl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 274.13 g/mol, XLogP of 3.82, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dichlorophenyl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 43156441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).