2-(4-ethylphenyl)-1,3-thiazole-5-carboxylic acid

C12H11NO2S — CID 43156460

IUPAC2-(4-ethylphenyl)-1,3-thiazole-5-carboxylic acid
SMILESCCc1ccc(-c2ncc(C(=O)O)s2)cc1
InChIInChI=1S/C12H11NO2S/c1-2-8-3-5-9(6-4-8)11-13-7-10(16-11)12(14)15/h3-7H,2H2,1H3,(H,14,15)
InChIKeyUWLNOZRTYPCBSD-UHFFFAOYSA-N
MW233.29 g/mol
LogP3.07
Rot. Bonds3

About 2-(4-ethylphenyl)-1,3-thiazole-5-carboxylic acid

2-(4-ethylphenyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 43156460) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(4-ethylphenyl)-1,3-thiazole-5-carboxylic acid
PubChem CID43156460
Molecular FormulaC12H11NO2S
Molecular Weight233.29 g/mol
Exact Mass233.05
IUPAC Name2-(4-ethylphenyl)-1,3-thiazole-5-carboxylic acid
SMILESCCc1ccc(-c2ncc(C(=O)O)s2)cc1
InChIInChI=1S/C12H11NO2S/c1-2-8-3-5-9(6-4-8)11-13-7-10(16-11)12(14)15/h3-7H,2H2,1H3,(H,14,15)
InChIKeyUWLNOZRTYPCBSD-UHFFFAOYSA-N
XLogP3.07
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.29
LogP ≤ 53.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(4-ethylphenyl)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-ethylphenyl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(4-ethylphenyl)-1,3-thiazole-5-carboxylic acid (CID 43156460) is 2-(4-ethylphenyl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(4-ethylphenyl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(4-ethylphenyl)-1,3-thiazole-5-carboxylic acid is CCc1ccc(-c2ncc(C(=O)O)s2)cc1.
What is the InChIKey of 2-(4-ethylphenyl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is UWLNOZRTYPCBSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2S/c1-2-8-3-5-9(6-4-8)11-13-7-10(16-11)12(14)15/h3-7H,2H2,1H3,(H,14,15).
What are the key properties of 2-(4-ethylphenyl)-1,3-thiazole-5-carboxylic acid?
2-(4-ethylphenyl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 233.29 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethylphenyl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 43156460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).