About 3-cyclohexyl-4-methyl-1,2-oxazol-5-amine
3-cyclohexyl-4-methyl-1,2-oxazol-5-amine (PubChem CID 43158311) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-cyclohexyl-4-methyl-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | 3-cyclohexyl-4-methyl-1,2-oxazol-5-amine |
| PubChem CID | 43158311 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3-cyclohexyl-4-methyl-1,2-oxazol-5-amine |
| SMILES | Cc1c(C2CCCCC2)noc1N |
| InChI | InChI=1S/C10H16N2O/c1-7-9(12-13-10(7)11)8-5-3-2-4-6-8/h8H,2-6,11H2,1H3 |
| InChIKey | FUUBXBCVVUYQMO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclohexyl-4-methyl-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-4-methyl-1,2-oxazol-5-amine?
The IUPAC name of 3-cyclohexyl-4-methyl-1,2-oxazol-5-amine (CID 43158311) is 3-cyclohexyl-4-methyl-1,2-oxazol-5-amine.
What is the SMILES notation for 3-cyclohexyl-4-methyl-1,2-oxazol-5-amine?
The canonical SMILES for 3-cyclohexyl-4-methyl-1,2-oxazol-5-amine is Cc1c(C2CCCCC2)noc1N.
What is the InChIKey of 3-cyclohexyl-4-methyl-1,2-oxazol-5-amine?
The InChIKey is FUUBXBCVVUYQMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-7-9(12-13-10(7)11)8-5-3-2-4-6-8/h8H,2-6,11H2,1H3.
What are the key properties of 3-cyclohexyl-4-methyl-1,2-oxazol-5-amine?
3-cyclohexyl-4-methyl-1,2-oxazol-5-amine has a molecular weight of 180.25 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-4-methyl-1,2-oxazol-5-amine is sourced from PubChem (CID 43158311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).