About 2-bromo-6-(5-methylfuran-2-yl)imidazo[2,1-b][1,3,4]thiadiazole
2-bromo-6-(5-methylfuran-2-yl)imidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 43159283) has the molecular formula C9H6BrN3OS
and a molecular weight of 284.14 g/mol. Its IUPAC name is 2-bromo-6-(5-methylfuran-2-yl)imidazo[2,1-b][1,3,4]thiadiazole.
Molecular Properties
| Compound Name | 2-bromo-6-(5-methylfuran-2-yl)imidazo[2,1-b][1,3,4]thiadiazole |
| PubChem CID | 43159283 |
| Molecular Formula | C9H6BrN3OS |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 282.94 |
| IUPAC Name | 2-bromo-6-(5-methylfuran-2-yl)imidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | Cc1ccc(-c2cn3nc(Br)sc3n2)o1 |
| InChI | InChI=1S/C9H6BrN3OS/c1-5-2-3-7(14-5)6-4-13-9(11-6)15-8(10)12-13/h2-4H,1H3 |
| InChIKey | LARBYUIJHRHBKW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-bromo-6-(5-methylfuran-2-yl)imidazo[2,1-b][1,3,4]thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-(5-methylfuran-2-yl)imidazo[2,1-b][1,3,4]thiadiazole?
The IUPAC name of 2-bromo-6-(5-methylfuran-2-yl)imidazo[2,1-b][1,3,4]thiadiazole (CID 43159283) is 2-bromo-6-(5-methylfuran-2-yl)imidazo[2,1-b][1,3,4]thiadiazole.
What is the SMILES notation for 2-bromo-6-(5-methylfuran-2-yl)imidazo[2,1-b][1,3,4]thiadiazole?
The canonical SMILES for 2-bromo-6-(5-methylfuran-2-yl)imidazo[2,1-b][1,3,4]thiadiazole is Cc1ccc(-c2cn3nc(Br)sc3n2)o1.
What is the InChIKey of 2-bromo-6-(5-methylfuran-2-yl)imidazo[2,1-b][1,3,4]thiadiazole?
The InChIKey is LARBYUIJHRHBKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrN3OS/c1-5-2-3-7(14-5)6-4-13-9(11-6)15-8(10)12-13/h2-4H,1H3.
What are the key properties of 2-bromo-6-(5-methylfuran-2-yl)imidazo[2,1-b][1,3,4]thiadiazole?
2-bromo-6-(5-methylfuran-2-yl)imidazo[2,1-b][1,3,4]thiadiazole has a molecular weight of 284.14 g/mol, XLogP of 3.12, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-(5-methylfuran-2-yl)imidazo[2,1-b][1,3,4]thiadiazole is sourced from PubChem (CID 43159283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).