About 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide
5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide (PubChem CID 43159652) has the molecular formula C6H7F3N4O
and a molecular weight of 208.14 g/mol. Its IUPAC name is 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide |
| PubChem CID | 43159652 |
| Molecular Formula | C6H7F3N4O |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide |
| SMILES | Nc1[nH]ncc1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H7F3N4O/c7-6(8,9)2-11-5(14)3-1-12-13-4(3)10/h1H,2H2,(H,11,14)(H3,10,12,13) |
| InChIKey | ZMUVJOKLLGPXAP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide?
The IUPAC name of 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide (CID 43159652) is 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide.
What is the SMILES notation for 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide?
The canonical SMILES for 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide is Nc1[nH]ncc1C(=O)NCC(F)(F)F.
What is the InChIKey of 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide?
The InChIKey is ZMUVJOKLLGPXAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F3N4O/c7-6(8,9)2-11-5(14)3-1-12-13-4(3)10/h1H,2H2,(H,11,14)(H3,10,12,13).
What are the key properties of 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide?
5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide has a molecular weight of 208.14 g/mol, XLogP of 0.28, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 43159652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).