About 2-N-[(4-methoxyphenyl)methyl]thiophene-2,5-disulfonamide
2-N-[(4-methoxyphenyl)methyl]thiophene-2,5-disulfonamide (PubChem CID 4316) has the molecular formula C12H14N2O5S3
and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-N-[(4-methoxyphenyl)methyl]thiophene-2,5-disulfonamide.
Molecular Properties
| Compound Name | 2-N-[(4-methoxyphenyl)methyl]thiophene-2,5-disulfonamide |
| PubChem CID | 4316 |
| Molecular Formula | C12H14N2O5S3 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2-N-[(4-methoxyphenyl)methyl]thiophene-2,5-disulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2ccc(S(N)(=O)=O)s2)cc1 |
| InChI | InChI=1S/C12H14N2O5S3/c1-19-10-4-2-9(3-5-10)8-14-22(17,18)12-7-6-11(20-12)21(13,15)16/h2-7,14H,8H2,1H3,(H2,13,15,16) |
| InChIKey | LRRAIRJIZOLGPR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-N-[(4-methoxyphenyl)methyl]thiophene-2,5-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[(4-methoxyphenyl)methyl]thiophene-2,5-disulfonamide?
The IUPAC name of 2-N-[(4-methoxyphenyl)methyl]thiophene-2,5-disulfonamide (CID 4316) is 2-N-[(4-methoxyphenyl)methyl]thiophene-2,5-disulfonamide.
What is the SMILES notation for 2-N-[(4-methoxyphenyl)methyl]thiophene-2,5-disulfonamide?
The canonical SMILES for 2-N-[(4-methoxyphenyl)methyl]thiophene-2,5-disulfonamide is COc1ccc(CNS(=O)(=O)c2ccc(S(N)(=O)=O)s2)cc1.
What is the InChIKey of 2-N-[(4-methoxyphenyl)methyl]thiophene-2,5-disulfonamide?
The InChIKey is LRRAIRJIZOLGPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O5S3/c1-19-10-4-2-9(3-5-10)8-14-22(17,18)12-7-6-11(20-12)21(13,15)16/h2-7,14H,8H2,1H3,(H2,13,15,16).
What are the key properties of 2-N-[(4-methoxyphenyl)methyl]thiophene-2,5-disulfonamide?
2-N-[(4-methoxyphenyl)methyl]thiophene-2,5-disulfonamide has a molecular weight of 362.45 g/mol, XLogP of 0.88, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[(4-methoxyphenyl)methyl]thiophene-2,5-disulfonamide is sourced from PubChem (CID 4316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).