C16H15BrO3 — CID 43161114
(2-bromo-4,5-dimethoxyphenyl)-(3-methylphenyl)methanone (PubChem CID 43161114) has the molecular formula C16H15BrO3 and a molecular weight of 335.20 g/mol. Its IUPAC name is (2-bromo-4,5-dimethoxyphenyl)-(3-methylphenyl)methanone.
| Compound Name | (2-bromo-4,5-dimethoxyphenyl)-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 43161114 |
| Molecular Formula | C16H15BrO3 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | (2-bromo-4,5-dimethoxyphenyl)-(3-methylphenyl)methanone |
| SMILES | COc1cc(Br)c(C(=O)c2cccc(C)c2)cc1OC |
| InChI | InChI=1S/C16H15BrO3/c1-10-5-4-6-11(7-10)16(18)12-8-14(19-2)15(20-3)9-13(12)17/h4-9H,1-3H3 |
| InChIKey | VTOZDOJXMWABCN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |