About 5-(2-ethylhexanoyl)-1,3-dimethylpyrimidine-2,4-dione
5-(2-ethylhexanoyl)-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 43161191) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is 5-(2-ethylhexanoyl)-1,3-dimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(2-ethylhexanoyl)-1,3-dimethylpyrimidine-2,4-dione |
| PubChem CID | 43161191 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 5-(2-ethylhexanoyl)-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | CCCCC(CC)C(=O)c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H22N2O3/c1-5-7-8-10(6-2)12(17)11-9-15(3)14(19)16(4)13(11)18/h9-10H,5-8H2,1-4H3 |
| InChIKey | FYWJFXIWLRSGAH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2-ethylhexanoyl)-1,3-dimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-ethylhexanoyl)-1,3-dimethylpyrimidine-2,4-dione?
The IUPAC name of 5-(2-ethylhexanoyl)-1,3-dimethylpyrimidine-2,4-dione (CID 43161191) is 5-(2-ethylhexanoyl)-1,3-dimethylpyrimidine-2,4-dione.
What is the SMILES notation for 5-(2-ethylhexanoyl)-1,3-dimethylpyrimidine-2,4-dione?
The canonical SMILES for 5-(2-ethylhexanoyl)-1,3-dimethylpyrimidine-2,4-dione is CCCCC(CC)C(=O)c1cn(C)c(=O)n(C)c1=O.
What is the InChIKey of 5-(2-ethylhexanoyl)-1,3-dimethylpyrimidine-2,4-dione?
The InChIKey is FYWJFXIWLRSGAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O3/c1-5-7-8-10(6-2)12(17)11-9-15(3)14(19)16(4)13(11)18/h9-10H,5-8H2,1-4H3.
What are the key properties of 5-(2-ethylhexanoyl)-1,3-dimethylpyrimidine-2,4-dione?
5-(2-ethylhexanoyl)-1,3-dimethylpyrimidine-2,4-dione has a molecular weight of 266.34 g/mol, XLogP of 1.48, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-ethylhexanoyl)-1,3-dimethylpyrimidine-2,4-dione is sourced from PubChem (CID 43161191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).