About cyclobutyl-(2,5-dimethylthiophen-3-yl)methanone
cyclobutyl-(2,5-dimethylthiophen-3-yl)methanone (PubChem CID 43161431) has the molecular formula C11H14OS
and a molecular weight of 194.30 g/mol. Its IUPAC name is cyclobutyl-(2,5-dimethylthiophen-3-yl)methanone.
Molecular Properties
| Compound Name | cyclobutyl-(2,5-dimethylthiophen-3-yl)methanone |
| PubChem CID | 43161431 |
| Molecular Formula | C11H14OS |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | cyclobutyl-(2,5-dimethylthiophen-3-yl)methanone |
| SMILES | Cc1cc(C(=O)C2CCC2)c(C)s1 |
| InChI | InChI=1S/C11H14OS/c1-7-6-10(8(2)13-7)11(12)9-4-3-5-9/h6,9H,3-5H2,1-2H3 |
| InChIKey | AKQCEYMSUUDBOK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclobutyl-(2,5-dimethylthiophen-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl-(2,5-dimethylthiophen-3-yl)methanone?
The IUPAC name of cyclobutyl-(2,5-dimethylthiophen-3-yl)methanone (CID 43161431) is cyclobutyl-(2,5-dimethylthiophen-3-yl)methanone.
What is the SMILES notation for cyclobutyl-(2,5-dimethylthiophen-3-yl)methanone?
The canonical SMILES for cyclobutyl-(2,5-dimethylthiophen-3-yl)methanone is Cc1cc(C(=O)C2CCC2)c(C)s1.
What is the InChIKey of cyclobutyl-(2,5-dimethylthiophen-3-yl)methanone?
The InChIKey is AKQCEYMSUUDBOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14OS/c1-7-6-10(8(2)13-7)11(12)9-4-3-5-9/h6,9H,3-5H2,1-2H3.
What are the key properties of cyclobutyl-(2,5-dimethylthiophen-3-yl)methanone?
cyclobutyl-(2,5-dimethylthiophen-3-yl)methanone has a molecular weight of 194.30 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl-(2,5-dimethylthiophen-3-yl)methanone is sourced from PubChem (CID 43161431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).