C25H22INO5 — CID 4316166
1-[(3,4-dimethoxyphenyl)methyl]-3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]indol-2-one (PubChem CID 4316166) has the molecular formula C25H22INO5 and a molecular weight of 543.36 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]indol-2-one.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 4316166 |
| Molecular Formula | C25H22INO5 |
| Molecular Weight | 543.36 g/mol |
| Exact Mass | 543.05 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]indol-2-one |
| SMILES | COc1ccc(CN2C(=O)C(O)(CC(=O)c3ccc(I)cc3)c3ccccc32)cc1OC |
| InChI | InChI=1S/C25H22INO5/c1-31-22-12-7-16(13-23(22)32-2)15-27-20-6-4-3-5-19(20)25(30,24(27)29)14-21(28)17-8-10-18(26)11-9-17/h3-13,30H,14-15H2,1-2H3 |
| InChIKey | JZKJOMWSXQIKJG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|