C14H7F2NO3 — CID 43161914
6-(2,4-difluorobenzoyl)-3H-1,3-benzoxazol-2-one (PubChem CID 43161914) has the molecular formula C14H7F2NO3 and a molecular weight of 275.21 g/mol. Its IUPAC name is 6-(2,4-difluorobenzoyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(2,4-difluorobenzoyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 43161914 |
| Molecular Formula | C14H7F2NO3 |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 6-(2,4-difluorobenzoyl)-3H-1,3-benzoxazol-2-one |
| SMILES | O=C(c1ccc2[nH]c(=O)oc2c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H7F2NO3/c15-8-2-3-9(10(16)6-8)13(18)7-1-4-11-12(5-7)20-14(19)17-11/h1-6H,(H,17,19) |
| InChIKey | JOBHJYQFHOSYTB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |