About 5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole
5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole (PubChem CID 43162323) has the molecular formula C7H12N4O
and a molecular weight of 168.20 g/mol. Its IUPAC name is 5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole |
| PubChem CID | 43162323 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole |
| SMILES | c1noc(CN2CCNCC2)n1 |
| InChI | InChI=1S/C7H12N4O/c1-3-11(4-2-8-1)5-7-9-6-10-12-7/h6,8H,1-5H2 |
| InChIKey | NHGYSDXRXPUDFN-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole?
The IUPAC name of 5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole (CID 43162323) is 5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole.
What is the SMILES notation for 5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole?
The canonical SMILES for 5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole is c1noc(CN2CCNCC2)n1.
What is the InChIKey of 5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole?
The InChIKey is NHGYSDXRXPUDFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O/c1-3-11(4-2-8-1)5-7-9-6-10-12-7/h6,8H,1-5H2.
What are the key properties of 5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole?
5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole has a molecular weight of 168.20 g/mol, XLogP of -0.53, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(piperazin-1-ylmethyl)-1,2,4-oxadiazole is sourced from PubChem (CID 43162323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).