C14H18N2O — CID 43162648
3-amino-2-pentylisoquinolin-1-one (PubChem CID 43162648) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-amino-2-pentylisoquinolin-1-one.
| Compound Name | 3-amino-2-pentylisoquinolin-1-one |
|---|---|
| PubChem CID | 43162648 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 3-amino-2-pentylisoquinolin-1-one |
| SMILES | CCCCCn1c(N)cc2ccccc2c1=O |
| InChI | InChI=1S/C14H18N2O/c1-2-3-6-9-16-13(15)10-11-7-4-5-8-12(11)14(16)17/h4-5,7-8,10H,2-3,6,9,15H2,1H3 |
| InChIKey | SATCGOAPMGIZAL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|