C16H12Cl2N2O — CID 43162653
3-amino-2-(2,6-dichloro-3-methylphenyl)isoquinolin-1-one (PubChem CID 43162653) has the molecular formula C16H12Cl2N2O and a molecular weight of 319.19 g/mol. Its IUPAC name is 3-amino-2-(2,6-dichloro-3-methylphenyl)isoquinolin-1-one.
| Compound Name | 3-amino-2-(2,6-dichloro-3-methylphenyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 43162653 |
| Molecular Formula | C16H12Cl2N2O |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 3-amino-2-(2,6-dichloro-3-methylphenyl)isoquinolin-1-one |
| SMILES | Cc1ccc(Cl)c(-n2c(N)cc3ccccc3c2=O)c1Cl |
| InChI | InChI=1S/C16H12Cl2N2O/c1-9-6-7-12(17)15(14(9)18)20-13(19)8-10-4-2-3-5-11(10)16(20)21/h2-8H,19H2,1H3 |
| InChIKey | NFAFQUNLZDAKLO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |